| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Cefprozil EP Impurity L
CAS:203007-73-2
Purity:95% HPLC Package:10mg;25mg;50mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Cefprozil Impurity 12（Cefprozil EP Impurity L）
CAS:203007-73-2
Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
|
| | Cefprozil IMpurity L Basic information |
| Product Name: | Cefprozil IMpurity L | | Synonyms: | Cefprozil IMpurity L;2-hydroxyethyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate;Cefprozil Impurity 12（Cefprozil EP Impurity L）;Cefprozil EP impurity L/2-hydroxyethyl (R)-2-amino-2-(4-hydroxyphenyl)acetate/D(-)-4-Hydroxyphenylglycine Hydroxy Ethyl Ester;Benzeneacetic acid, α-amino-4-hydroxy-, 2-hydroxyethyl ester, (αR)-;2-hydroxyethyl (R)-2-amino-2-(4-hydroxyphenyl)acetate;(R)-α-Amino-4-hydroxy-Benzeneacetic Acid 2-Hydroxyethyl Ester;CefprozilImpurity L(Hydroxyethyl p-Hydroxyphenylglycinate) | | CAS: | 203007-73-2 | | MF: | C10H13NO4 | | MW: | 211.21 | | EINECS: | | | Product Categories: | | | Mol File: | 203007-73-2.mol |  |
| | Cefprozil IMpurity L Chemical Properties |
| Boiling point | 422.6±35.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | pka | 9.71±0.26(Predicted) | | InChIKey | WDLWHQDACQUCJR-DKZKUXEMNA-N | | SMILES | O=C(O)C1=C(CS[C@]2([C@@H](C(=O)N12)NC(=O)[C@@H](C1=CC=C(O)C=C1)N)[H])/C=C/C |&1:7,8,15,r| |
| | Cefprozil IMpurity L Usage And Synthesis |
| Uses | (R)-α-Amino-4-hydroxy-Benzeneacetic Acid 2-Hydroxyethyl Ester, is a building block used in the synthesis of various chemical compounds, such as Cefprozil, an antibacterial. |
| | Cefprozil IMpurity L Preparation Products And Raw materials |
|