|
|
| | 3-Bromoisoxazole-5-carboxylic acid Basic information |
| | 3-Bromoisoxazole-5-carboxylic acid Chemical Properties |
| Melting point | 170-175 °C | | Boiling point | 375.2±27.0 °C(Predicted) | | density | 2.038±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 1.90±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H2BrNO3/c5-3-1-2(4(7)8)9-6-3/h1H,(H,7,8) | | InChIKey | YNIMFLBFJCGBQK-UHFFFAOYSA-N | | SMILES | O1C(C(O)=O)=CC(Br)=N1 |
| | 3-Bromoisoxazole-5-carboxylic acid Usage And Synthesis |
| Uses | 3-Bromoisoxazole-5-carboxylic Acid has been used for the preparation of oxazolidinone with substituted isoxazole derivatives to be used as antibacterial agents. |
| | 3-Bromoisoxazole-5-carboxylic acid Preparation Products And Raw materials |
|