| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Ornidazole IsoMer (IMpurity) Basic information |
| | Ornidazole IsoMer (IMpurity) Chemical Properties |
| Melting point | 151-153 °C | | Boiling point | 443.2±40.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.29±0.20(Predicted) | | color | White to Off-White | | Stability: | Light Sensitive | | SMILES | c1-c([N+]([O-])=O)nc(C)-[n]1CC(O)CCl |
| | Ornidazole IsoMer (IMpurity) Usage And Synthesis |
| Uses | An isomeric impurity of Ornidazole, which maintains anti-infective properties. | | Uses | An isomeric impurity of Ornidazole (0688500), which maintains anti-infective properties. |
| | Ornidazole IsoMer (IMpurity) Preparation Products And Raw materials |
|