|
|
| | Secnidazole heMihydrate Basic information |
| Product Name: | Secnidazole heMihydrate | | Synonyms: | Secnidazole heMihydrate;α,2-Dimethyl-5-nitro-1H-imidazole-1-ethanol hemihydrate;(RS)-1-(2-Methyl-5-nitroimidazol-1-yl)-2-propanol hemihydrate;Secnidazole hydrate | | CAS: | 227622-73-3 | | MF: | C14H24N6O7 | | MW: | 388.37636 | | EINECS: | | | Product Categories: | | | Mol File: | 227622-73-3.mol |  |
| | Secnidazole heMihydrate Chemical Properties |
| BRN | 8791511 | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | 1S/2C7H11N3O3.H2O/c2*1-5(11)4-9-6(2)8-3-7(9)10(12)13;/h2*3,5,11H,4H2,1-2H3;1H2 | | InChIKey | LPCFEXQLJSCCMQ-UHFFFAOYSA-N | | SMILES | O.CC(O)Cn1c(C)ncc1[N+]([O-])=O.CC(O)Cn2c(C)ncc2[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 63 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | Secnidazole heMihydrate Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | | in vivo | Secnidazole (RP-14539) hemihydrate (100 μL; ip.; for 5 days) has protective activity against S.marcescens pathogenesis and can diminish its pathogenesis in mice[3]. | Animal Model: | Female healthy albino mice[3] | | Dosage: | 100 μL | | Administration: | 100 μL; ip.; for 5 days | | Result: | Significantly diminished the bacteria s capacity to kill mice. |
| | IC 50 | Amebae |
| | Secnidazole heMihydrate Preparation Products And Raw materials |
|