| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 1-Descarboxy Ketorolac Basic information |
| Product Name: | 1-Descarboxy Ketorolac | | Synonyms: | 1-Descarboxy Ketorolac;6,7-dihydro-5H-pyrrolizin-3-yl(phenyl)methanone;Ketorolac Impurity 12;Methanone, (2,3-dihydro-1H-pyrrolizin-5-yl)phenyl-;Etodolac Impurity 13 （1-Descarboxy Ketorolac);Ketorolac Impurity 11（EP Impurity I）;Deoxyepinephrine ketorolac EP impurity I;Ketorolac EP Impurity I/ Ketorolac Related Compound D (1-Decarboxy Ketorolac) | | CAS: | 113502-55-9 | | MF: | C14H13NO | | MW: | 211.26 | | EINECS: | | | Product Categories: | | | Mol File: | 113502-55-9.mol |  |
| | 1-Descarboxy Ketorolac Chemical Properties |
| Melting point | >95°C (dec.) | | Boiling point | 385.2±30.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | -5.50±0.20(Predicted) | | form | Solid | | color | Yellow to Dark Grey | | Major Application | pharmaceutical | | InChI | 1S/C14H13NO/c16-14(11-5-2-1-3-6-11)13-9-8-12-7-4-10-15(12)13/h1-3,5-6,8-9H,4,7,10H2 | | InChIKey | DHUITNLXEMJSMU-UHFFFAOYSA-N | | SMILES | [n]21c(ccc2C(=O)c3ccccc3)CCC1 |
| WGK Germany | WGK 3 | | HS Code | 2933998350 | | Storage Class | 13 - Non Combustible Solids |
| | 1-Descarboxy Ketorolac Usage And Synthesis |
| Uses | 1-Descarboxy Ketodolac is an impurity in the synthesis of (R)-Ketorolac (K235600). The (S)-enantiomer is about 60 times more potent than (R)-enantiomer. Prostaglandin biosynthesis inhibitor. Analgesic; anti-inflammatory. |
| | 1-Descarboxy Ketorolac Preparation Products And Raw materials |
|