| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Ketorolac EP IMpurity G Basic information |
| Product Name: | Ketorolac EP IMpurity G | | Synonyms: | Ketorolac EP IMpurity G;Ketorolac IMpurity G;BVOPXASBFYEPRL-UHFFFAOYSA-N;Ketorolac Tromethamine Impurity G;Methyl 5-benzoyl-1-hydroxy2,3-dihydro-1H-pyrrolizine-1-carboxylate,(+/-)-;1H-Pyrrolizine-1-carboxylic acid, 5-benzoyl-2,3-dihydro-1-hydroxy-, methyl ester;Ketorolac Impurity 9（EP Impurity G）;Ketorolac EP Impurity G (1-Hydroxy Ketorolac Methyl Ester) | | CAS: | 1391051-90-3 | | MF: | C16H15NO4 | | MW: | 285.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1391051-90-3.mol |  |
| | Ketorolac EP IMpurity G Chemical Properties |
| Boiling point | 467.0±45.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 12.56±0.20(Predicted) | | form | Solid | | color | Off White to Beige | | Major Application | pharmaceutical | | InChI | InChI=1S/C16H15NO4/c1-21-15(19)16(20)9-10-17-12(7-8-13(16)17)14(18)11-5-3-2-4-6-11/h2-8,20H,9-10H2,1H3 | | InChIKey | BVOPXASBFYEPRL-UHFFFAOYSA-N | | SMILES | N12CCC(O)(C(OC)=O)C1=CC=C2C(=O)C1=CC=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | Ketorolac EP IMpurity G Usage And Synthesis |
| Uses | An impurity of Ketorolac (K235650). |
| | Ketorolac EP IMpurity G Preparation Products And Raw materials |
|