|
|
| | Acetoxyvalerenic Acid Basic information |
| Product Name: | Acetoxyvalerenic Acid | | Synonyms: | 2-Propenoic acid, 3-[(1R,4S,7R,7aR)-1-(acetyloxy)-2,4,5,6,7,7a-hexahydro-3,7-dimethyl-1H-inden-4-yl]-2-methyl-, (2E)-;Valerenic Acid Acetoxy Impurity;Inhibitor,ACETOXYVALERENIC ACID,inhibit;(E)-3-((1R,4S,7R,7aR)-1-Acetoxy-3,7-dimethyl-2,4,5,6,7,7a-hexahydro-1H-inden-4-yl)-2-methylacrylic acid;ACETOXYVALERENIC ACID, 10 mM in DMSO | | CAS: | 84638-55-1 | | MF: | C17H24O4 | | MW: | 292.37 | | EINECS: | | | Product Categories: | | | Mol File: | 84638-55-1.mol |  |
| | Acetoxyvalerenic Acid Chemical Properties |
| Boiling point | 427.0±45.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform: sparingly; Ethanol: very slightly, sonicated; Methanol: slightly | | form | solid | | pka | 4.88±0.19(Predicted) | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C17H24O4/c1-9-5-6-13(7-11(3)17(19)20)15-10(2)8-14(16(9)15)21-12(4)18/h7,9,13-14,16H,5-6,8H2,1-4H3,(H,19,20)/b11-7+/t9-,13+,14-,16+/m1/s1 | | InChIKey | VBBXZFLAYWAXSK-HYJCDKNOSA-N | | SMILES | O([C@H]1[C@@H]2[C@@H](CC[C@H](C2=C(C1)C)\C=C(/C)\C(=O)O)C)C(=O)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Acetoxyvalerenic Acid Usage And Synthesis |
| Uses | Acetoxyvalerenic Acid (A165400) combined with valerenic acid extracts could be used for treatment and prophylaxis of GABA-related disorders such as anxiety, depression, restlessness and insomnia. |
| | Acetoxyvalerenic Acid Preparation Products And Raw materials |
|