- Continentalic acid
-
-
2023-02-24
- CAS:19889-23-7
- Min. Order: 20mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | Continentalic acid Basic information |
| Product Name: | Continentalic acid | | Synonyms: | Continentalic acid;1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aS,4bR,7R,10aS)-;Continentalic acid,Bacterial,inhibit,Inhibitor;(1R,4aS,4bR,7R,10aS)-1,4a,7-Trimethyl-7-vinyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydrophenanthrene-1-carboxylic acid | | CAS: | 19889-23-7 | | MF: | C20H30O2 | | MW: | 302.45 | | EINECS: | | | Product Categories: | | | Mol File: | 19889-23-7.mol |  |
| | Continentalic acid Chemical Properties |
| Melting point | 163-164 °C | | Boiling point | 413.2±45.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:3.02(Max Conc. mg/mL);10.0(Max Conc. mM) | | form | A solid | | pka | 4.68±0.60(Predicted) | | color | White to off-white | | InChIKey | MHVJRKBZMUDEEV-XIHRTOKZSA-N | | SMILES | OC(=O)[C@]1([C@@H]2[C@]([C@@H]3CC[C@](C=C3CC2)(C)C=C)(CCC1)C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Continentalic acid Usage And Synthesis |
| Uses | Continentalic Acid is a diterpenic acid isolated from the roots of Aralia continentalis. It shows significant anti-inflammatory activity, and was found to induce growth inhibition and apoptosis of HepG2 cells, proving to be a good candidate as an effective chemotherapeutic agent. |
| | Continentalic acid Preparation Products And Raw materials |
|