|
|
| | (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate HCl Basic information |
| Product Name: | (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate HCl | | Synonyms: | (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate HCl;(R)-METHYL 3-AMINO-3-(4-BROMOPHENYL)PROPANOATE HYDROCHLORIDE;methyl (3R)-3-amino-3-(4-bromophenyl)propanoate hydrochloride;(R)-β-Phe(4-Br)-OMe.HCl;methyl(R)-3-amino-3-(4-bromophenyl)propanoate hydrochloride;(R) 3-amino-3- (4-bromophenyl) propionic acid methyl ester hydrochloride (R form);(R) 3-amino-3- (4-bromophenyl) propionic acid methyl ester hydrochloride | | CAS: | 845908-98-7 | | MF: | C10H13BrClNO2 | | MW: | 294.57 | | EINECS: | | | Product Categories: | | | Mol File: | 845908-98-7.mol |  |
| | (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate HCl Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C10H12BrNO2.ClH/c1-14-10(13)6-9(12)7-2-4-8(11)5-3-7;/h2-5,9H,6,12H2,1H3;1H/t9-;/s3 | | InChIKey | KCAPQHNPIIVGSF-OVMXBOEKNA-N | | SMILES | [C@@H](C1C=CC(Br)=CC=1)(N)CC(=O)OC.Cl |&1:0,r| |
| | (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate HCl Usage And Synthesis |
| | (R)-Methyl 3-amino-3-(4-bromophenyl)propanoate HCl Preparation Products And Raw materials |
|