| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5] manufacturers
|
| | cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5] Basic information |
| Product Name: | cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5] | | Synonyms: | cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5];CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID (19,19,20,20,20-D5, 98%);Eicosapentaenoic Acid-d5 MaxSpec? Standard;2H5]-(5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoic acid;Eicosapentaenoic Acid-d5 (>85%);cis-5,8,11,14,17-Eicosapentaenoic acid-19,19,20,20,20-d?;19,19,20,20,20-2H5]-cis-5,8,11,14,17-Eicosapentaenoic acid;cis-5,8,11,14,17-Eicosapentaenoic acid-19,19,20,20,20-d5 | | CAS: | 1197205-73-4 | | MF: | C20H30O2 | | MW: | 302.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1197205-73-4.mol | ![cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5] Structure](CAS/20180629/GIF/1197205-73-4.gif) |
| | cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5] Chemical Properties |
| Melting point | -54--53 °C (lit.) | | density | 0.958 g/mL at 25 °C | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Stability: | Light Sensitive | | InChIKey | JAZBEHYOTPTENJ-JLNKQSITSA-N | | SMILES | C(/C/C=C\CCCC(=O)O)=C/C/C=C\C/C=C\C/C=C\C([H])([H])C([H])([H])[H] | | CAS Number Unlabeled | 10417-94-4 |
| WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5] Usage And Synthesis |
| Uses | Eicosapentaenoic Acid (>85%) is an important polyunsaturated fatty acid of the marine food chain that serves as a precursor for the prostaglandin-3 and thromboxane-3 families. It differs from arachidonic acid (the eicosatetraenoic acid that is a precursor for the prostaglandin and thromboxane-2 families) by the extra double bond between the third and fourth carbons from the тАЬmethyl endтАЭ of the molecule. Antilipemic. | | Definition | ChEBI: EPA (d5) is a long-chain fatty acid and a deuterated fatty acid. |
| | cis-5,8,11,14,17-Eicosapentaenoic acid-[19,19,20,20,20-D5] Preparation Products And Raw materials |
|