| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | cis-5,8,11,14,17-Eicosapentaenoic acid sodium salt Basic information |
| Product Name: | cis-5,8,11,14,17-Eicosapentaenoic acid sodium salt | | Synonyms: | 5C,8C,11C,14C,17C-EICOSAPENTAENOIC ACID;5,8,11,14,17-EICOSAPENTAENOIC ACID;5Z,8Z,11Z,14Z,17Z-EICOSAPENTAENOIC ACID;ALL CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID;ALL CIS 5-8-11-14-17 EPA;ALL CIS-5,8,11,14,17-ICOSAPENTAENOIC ACID;C20:5 (ALL CIS-5,8,11,14,17) ACID;C20:5 OMEGA-3 | | CAS: | 73167-03-0 | | MF: | C20H30O2.Na | | MW: | 325.44 | | EINECS: | | | Product Categories: | Lipoxygenase (5-)Unsaturated fatty acids and derivatives;LipoxygenaseEnzyme Inhibitors by Enzyme;Omega 3 fatty acids and derivativesBiochemicals Found in Plants;Arachidonic Acid Cascade;Enzyme Inhibitors;L to;Lipids;Polyunsaturated | | Mol File: | 73167-03-0.mol |  |
| | cis-5,8,11,14,17-Eicosapentaenoic acid sodium salt Chemical Properties |
| Melting point | −54-−53 °C(lit.) | | density | 0.943 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4977(lit.) | | storage temp. | -20°C | | solubility | Ethanol: 1.5 mg/ml; Ethanol:PBS(pH 7.2) (1:5): 0.5 mg/ml | | form | waxy solid | | color | white | | biological source | synthetic (organic) | | InChIKey | TVEGTERCKGGVCJ-LIJGWLRISA-N | | SMILES | [Na].CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 3 | | WGK Germany | 3 | | F | 8-10-23 | | Storage Class | 11 - Combustible Solids |
| | cis-5,8,11,14,17-Eicosapentaenoic acid sodium salt Usage And Synthesis |
| Uses | reduces thromboxane A2 production and platelet aggregation, inhibits 5-lipoxygenase and prevents arteriosclerosis. | | Uses | cis-5,8,11,14,17-Eicosapentaenoic acid sodium salt has been used:
- to study its effect on the pathology of lupus in drug-induced and spontaneous mouse models
- to pretreat mouse alveolar macrophages to study the effect/relationship between amiodarone and eicosapentaenoic acid (EPA) concerning the cytokine release
- to examine if pharmacological correction with EPA supplementation might restore autophagic flux and reduce renal lipotoxicity in mice
| | General Description | Eicosapentaenoic acid (EPA)/timnodonic acid is an omega-3 polyunsaturated fatty acid (PUFA). This long-chain fatty acid is mainly found in fish oil. | | Biochem/physiol Actions | Eicosapentaenoic acid (EPA) possesses anti-hyperglycemic, anti-oxidant, anti-hyperlipidemic, and anti-inflammatory properties. It aids in improving vasoreactivity. EPA is capable of suppressing vascular smooth muscle proliferation. It ameliorates pulmonary hypertension by preventing Fyn kinase activity. EPA exhibits a beneficial effect on lipid metabolism. It is used to treat hypercholesterolemia and atherosclerosis. | | IC 50 | Human Endogenous Metabolite |
| | cis-5,8,11,14,17-Eicosapentaenoic acid sodium salt Preparation Products And Raw materials |
|