| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole Basic information |
| Product Name: | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole | | Synonyms: | 1-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole;1-Methyl-3-trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester >=97%;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole;1-Methyl-3-trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester;1H-Pyrazole, 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-;1-Methyl-3-(trifluoromethyl)-4-pyrazoleboronic Acid Pinacol Ester;1-Methyl-3-trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester;1-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole - [M17640] | | CAS: | 1218790-53-4 | | MF: | C11H16BF3N2O2 | | MW: | 276.06 | | EINECS: | | | Product Categories: | | | Mol File: | 1218790-53-4.mol |  |
| | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole Chemical Properties |
| Melting point | 99-100°C | | Boiling point | 324.6±42.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder or crystals | | pka | -0.87±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H16BF3N2O2/c1-9(2)10(3,4)19-12(18-9)7-6-17(5)16-8(7)11(13,14)15/h6H,1-5H3 | | InChIKey | MUZZCKPFJNQCIH-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1=NN(C)C=C1B2OC(C)(C)C(C)(C)O2 |
| Storage Class | 11 - Combustible Solids |
| | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole Usage And Synthesis |
| Uses | Useful boronic acid pinacol ester for synthesis of various bioactive small molecules. This product was previously listed as BML00234. |
| | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole Preparation Products And Raw materials |
|