3-Trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester manufacturers
|
| | 3-Trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester Basic information |
| Product Name: | 3-Trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester | | Synonyms: | 3-Trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester;3-(Trifluoromethyl)-1H-pyrazole-4-boronic acid pinacol ester 97%;4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole;(3-(TRIFLUOROMETHYL)-1H-PYRAZOL-4-YL)BORONIC ACID PINACOL ESTER;4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-5-(TRIFLUOROMETHYL)-1H-PYRAZOLE;4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1H-pyrazole;1H-Pyrazole, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-;3-(Trifluoromethyl)pyrazole-4-boronic Acid Pinacol Ester | | CAS: | 1218790-40-9 | | MF: | C10H14BF3N2O2 | | MW: | 262.04 | | EINECS: | | | Product Categories: | | | Mol File: | 1218790-40-9.mol |  |
| | 3-Trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester Chemical Properties |
| Melting point | 151-155°C | | Boiling point | 347.4±42.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.92±0.50(Predicted) | | form | solid | | color | White to off-white | | InChI | InChI=1S/C10H14BF3N2O2/c1-8(2)9(3,4)18-11(17-8)6-5-15-16-7(6)10(12,13)14/h5H,1-4H3,(H,15,16) | | InChIKey | WHYPQJYBTNZKBY-UHFFFAOYSA-N | | SMILES | N1C=C(B2OC(C)(C)C(C)(C)O2)C(C(F)(F)F)=N1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 1 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester Usage And Synthesis |
| Uses | [3-(Trifluoromethyl)-1H-pyrazol-4-yl]boronic Acid Pinacol Ester is a chemical reagent used in the synthesis of carboxamides used in the treatment of lymphomas, psoriasis and endometriosis. |
| | 3-Trifluoromethyl-1H-pyrazole-4-boronic acid pinacol ester Preparation Products And Raw materials |
|