| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Fluoro-2-methoxybenzoic acid Basic information |
| | 3-Fluoro-2-methoxybenzoic acid Chemical Properties |
| Melting point | 112-114°C | | Boiling point | 288℃ | | density | 1.307 | | Fp | 128℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.75±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H7FO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,1H3,(H,10,11) | | InChIKey | MEOOXZGGYVXUSG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(F)=C1OC | | CAS DataBase Reference | 106428-05-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Fluoro-2-methoxybenzoic acid Usage And Synthesis |
| Uses | 3-Fluoro-2-methoxybenzoic acid is a fluorobenzoic acid derivative that can be used as a synthetic intermediate in pharmaceutical synthesis.
|
| | 3-Fluoro-2-methoxybenzoic acid Preparation Products And Raw materials |
|