| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | ethyl 2-isopropyl-acrylate Basic information |
| Product Name: | ethyl 2-isopropyl-acrylate | | Synonyms: | Ethyl 3-methyl-2-methylenebutanoate;ethyl α-isopropylacrylate;Butanoic acid, 3-methyl-2-methylene-, ethyl ester;Ethyl 3-methyl-2-methylidenebutanoate | | CAS: | 68834-46-8 | | MF: | C8H14O2 | | MW: | 142.2 | | EINECS: | | | Product Categories: | | | Mol File: | 68834-46-8.mol |  |
| | ethyl 2-isopropyl-acrylate Chemical Properties |
| Boiling point | 148-150 °C(Press: 685 Torr) | | density | 0.8950 g/cm3 | | storage temp. | 2-8°C, sealed storage, away from moisture and light | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H14O2/c1-5-10-8(9)7(4)6(2)3/h6H,4-5H2,1-3H3 | | InChIKey | SLMXQFJPFDWFNW-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(=C)C(C)C |
| | ethyl 2-isopropyl-acrylate Usage And Synthesis |
| | ethyl 2-isopropyl-acrylate Preparation Products And Raw materials |
|