| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
alpha,beta-Methyleneadenosine 5'-diphosphate sodium salt manufacturers
- AMPCP
-
-
2026-07-27
- CAS:104835-70-3
- Purity:
- Supply Ability: 10g
|
| | alpha,beta-Methyleneadenosine 5'-diphosphate sodium salt Basic information |
| Product Name: | alpha,beta-Methyleneadenosine 5'-diphosphate sodium salt | | Synonyms: | A,B-methyleneadenosine 5'-diphosphate*sodium;AMP-CP SODIUM SALT;α,β-methyleneadenosine 5'-diphosphate sodium salt;α,β-Methyleneadenosine 5′-diphosphate sodium salt,AMP-CP;alpha,beta-Methyleneadenosine 5'-diphosphate sodium salt CD73 inhibitor;α,β-Methyleneadenosine 5′-diphosphate;(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid;Adenosine 5'-(α,β-methylene)diphosphate disodium salt New | | CAS: | 104835-70-3 | | MF: | C11H15N5Na2O9P2 | | MW: | 469.19 | | EINECS: | | | Product Categories: | | | Mol File: | 104835-70-3.mol |  |
| | alpha,beta-Methyleneadenosine 5'-diphosphate sodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | water: 50 mg/mL, clear to slightly hazy, colorless | | form | powder | | biological source | synthetic (organic) | | Water Solubility | water: 50mg/mL, clear to slightly hazy, colorless | | InChIKey | HEBWZOPLDYDXPJ-UHFFFAOYSA-N | | SMILES | [Na].Nc1ncnc2n(cnc12)C3OC(COP(O)(=O)CP(O)(O)=O)C(O)C3O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | alpha,beta-Methyleneadenosine 5'-diphosphate sodium salt Usage And Synthesis |
| Uses | α,β-Methyleneadenosine 5′-diphosphate sodium salt has been used as an ectonucleotidase/CD73 inhibitor to characterize the mode of adenosine production and as an inhibitor for in vitrostudies. | | Definition | ChEBI: Adenosine 5'-methylenediphosphate is a nucleoside diphosphate analogue. | | Biochem/physiol Actions | α, β-Methyleneadenosine 5′-diphosphate (AMP-CP) is an ADP analog that as an ability to inhibit ectonucleotidase/ CD73 inhibitor and is used to study adenosinergic signaling regulation via CD73/ecto-5′-nucleotidase. |
| | alpha,beta-Methyleneadenosine 5'-diphosphate sodium salt Preparation Products And Raw materials |
|