(S)-1-CYCLOPROPYLETHYLAMINE manufacturers
|
| | (S)-1-CYCLOPROPYLETHYLAMINE Basic information |
| Product Name: | (S)-1-CYCLOPROPYLETHYLAMINE | | Synonyms: | (S)-1-CYCLOPROPYLETHYLAMINE;(S)-1-Cyclopropylethylamine, ChiPros 98%, ee 98+%;(S)-1-CyclopropylethylaMine, ChiPros|r, 98%, ee 98+%;(S)-1-CyclopropylethylaMine ChiPros(R), produced by BASF, 99%;EOS-62097;(S)-1-cyclopropylethan-1-amine, 97.5%;Cyclopropanemethanamine, α-methyl-, (αS)-;(1S)-1-cyclopropylethan-1-amine | | CAS: | 195604-39-8 | | MF: | C5H11N | | MW: | 85.15 | | EINECS: | | | Product Categories: | | | Mol File: | 195604-39-8.mol |  |
| | (S)-1-CYCLOPROPYLETHYLAMINE Chemical Properties |
| Melting point | -68℃ | | Boiling point | 95°C | | density | 0.920 | | Fp | 95°C | | pka | 10.87±0.29(Predicted) | | form | liquid | | Water Solubility | Miscible with water. | | Sensitive | Air Sensitive | | InChI | InChI=1/C5H11N/c1-4(6)5-2-3-5/h4-5H,2-3,6H2,1H3/t4-/s3 | | InChIKey | IXCXVGWKYIDNOS-UFLUHPNLNA-N | | SMILES | C1([C@H](C)N)CC1 |&1:1,r| | | CAS DataBase Reference | 195604-39-8 |
| Hazard Codes | F,C | | Risk Statements | 11-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2
Skin Corr. 1B |
| | (S)-1-CYCLOPROPYLETHYLAMINE Usage And Synthesis |
| Uses | (S)-1-Cyclopropylethylamine acts as a chiral and organic building block in organic synthesis. |
| | (S)-1-CYCLOPROPYLETHYLAMINE Preparation Products And Raw materials |
|