|
|
| | 2-(2,4-Diphenyl-1,3-thiazol-5-yl)acetic acid Basic information |
| | 2-(2,4-Diphenyl-1,3-thiazol-5-yl)acetic acid Chemical Properties |
| Melting point | 153-155°C | | Boiling point | 535.7±52.0 °C(Predicted) | | density | 1.283±0.06 g/cm3(Predicted) | | storage temp. | -20°C, sealed storage, away from moisture | | pka | 3.91±0.10(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C17H13NO2S/c19-15(20)11-14-16(12-7-3-1-4-8-12)18-17(21-14)13-9-5-2-6-10-13/h1-10H,11H2,(H,19,20) | | InChIKey | WNGOHXAHAKLKAR-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1sc(nc1-c2ccccc2)-c3ccccc3 |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(2,4-Diphenyl-1,3-thiazol-5-yl)acetic acid Usage And Synthesis |
| | 2-(2,4-Diphenyl-1,3-thiazol-5-yl)acetic acid Preparation Products And Raw materials |
|