|
|
| | TRANS-NONACHLOR Basic information |
| Product Name: | TRANS-NONACHLOR | | Synonyms: | trans-Nonachlo;TRANS-NONACHLOR;TRANS NONACHLOR, 25MG, NEAT;TRANS-NONACHLOR, 1X1ML, HEX, 100UG/ML;trans-nonachlor solution;T-NONACHLOR;TRANS-NONACHLOR STANDARD;(1S,7R)-1α,2β,3β,4,5,6,7,8,8-Nonachloro-2,3,3aα,4,7,7aα-hexahydro-4,7-methano-1H-indene | | CAS: | 39765-80-5 | | MF: | C10H5Cl9 | | MW: | 444.22 | | EINECS: | 622-804-6 | | Product Categories: | NJ - NZMethod Specific;2000/60/EC;Alpha sort;European Community: ISO and DIN;N;N-PAlphabetic;Pesticides&Metabolites;N-OAlphabetic;Volatiles/ Semivolatiles;Environmental Standards;MetabolitesAlphabetic | | Mol File: | 39765-80-5.mol |  |
| | TRANS-NONACHLOR Chemical Properties |
| Melting point | 148℃ | | Boiling point | 522.25°C (rough estimate) | | density | 1.7470 (rough estimate) | | refractive index | 1.6000 (estimate) | | Fp | -26 °C | | storage temp. | APPROX 4°C | | form | Solid | | BRN | 8158568 | | Henry's Law Constant | 3.1×10-2 mol/(m3Pa) at 25℃, Jantunen and Bidleman (2006) | | Major Application | agriculture
environmental | | InChI | 1S/C10H5Cl9/c11-3-1-2(4(12)5(3)13)9(17)7(15)6(14)8(1,16)10(9,18)19/h1-5H/t1-,2+,3+,4-,5-,8-,9+ | | InChIKey | OCHOKXCPKDPNQU-FHPNKJTRSA-N | | SMILES | Cl[C@@H]1[C@@H](Cl)[C@H]2[C@@H]([C@H]1Cl)[C@]3(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C3(Cl)Cl | | EPA Substance Registry System | trans-Nonachlor (39765-80-5) |
| | TRANS-NONACHLOR Usage And Synthesis |
| Uses | trans-Nonachlordane, is an organochlorine pesticide/insecticide used in the protection of crops from pests. | | Definition | ChEBI: Trans-Nonachlor is an organochlorine compound. | | Safety Profile | Moderately toxic by ingestion.When heated to decomposition it emits toxic vapors ofClí. |
| | TRANS-NONACHLOR Preparation Products And Raw materials |
|