|
|
| | 3-Amino-5-(4-bromophenyl)thiophene-2-carboxylic acid methyl ester Basic information |
| Product Name: | 3-Amino-5-(4-bromophenyl)thiophene-2-carboxylic acid methyl ester | | Synonyms: | 3-Amino-5-(4-bromophenyl)thiophene-2-carbpoxylic acid methyl ester;METHYL-3-AMINO-5-(4-BROMOPHENYL)THIOPHENE 2-CARBOXYLATE;JR-9572, Methyl 3-amino-5-(4-bromophenyl)thiophene-2-carboxylate, 97%;2-Thiophenecarboxylic acid, 3-amino-5-(4-bromophenyl)-, methyl ester;3-Amino-5-(4-bromophenyl)thiophene-2-carboxylic acid methyl ester | | CAS: | 91076-95-8 | | MF: | C12H10BrNO2S | | MW: | 312.18 | | EINECS: | | | Product Categories: | | | Mol File: | 91076-95-8.mol |  |
| | 3-Amino-5-(4-bromophenyl)thiophene-2-carboxylic acid methyl ester Chemical Properties |
| Melting point | 146-148°C | | Boiling point | 484.5±45.0 °C(Predicted) | | density | 1.556±0.06 g/cm3(Predicted) | | pka | 1.52±0.10(Predicted) | | form | solid | | InChI | 1S/C12H10BrNO2S/c1-16-12(15)11-9(14)6-10(17-11)7-2-4-8(13)5-3-7/h2-6H,14H2,1H3 | | InChIKey | SUUSCMIMJCHEAB-UHFFFAOYSA-N | | SMILES | O=C(OC)C1=C(N)C=C(C(C=C2)=CC=C2Br)S1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Amino-5-(4-bromophenyl)thiophene-2-carboxylic acid methyl ester Usage And Synthesis |
| | 3-Amino-5-(4-bromophenyl)thiophene-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|