| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | tert-butyl (3S,5R)-5-fluoropiperidin-3-ylcarbamate Basic information |
| Product Name: | tert-butyl (3S,5R)-5-fluoropiperidin-3-ylcarbamate | | Synonyms: | tert-butyl (3S,5R)-5-fluoropiperidin-3-ylcarbaMate;tert-butyl N-[(3S,5R)-5-fluoropiperidin-3-yl]carbamate;(3S,5R)-(5-Fluoro-piperidin-3-yl)-carbamic acid tert-butyl ester;Carbamic acid, N-[(3S,5R)-5-fluoro-3-piperidinyl]-, 1,1-dimethylethyl ester;(3S,5R)-3-(Boc-amino)-5-fluoropiperidine | | CAS: | 1405128-38-2 | | MF: | C10H19FN2O2 | | MW: | 218.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1405128-38-2.mol |  |
| | tert-butyl (3S,5R)-5-fluoropiperidin-3-ylcarbamate Chemical Properties |
| Boiling point | 313.3±42.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 11.68±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-8-4-7(11)5-12-6-8/h7-8,12H,4-6H2,1-3H3,(H,13,14)/t7-,8+/m1/s1 | | InChIKey | ACHGEWOGBWGEEL-SFYZADRCSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1C[C@@H](F)CNC1 |
| | tert-butyl (3S,5R)-5-fluoropiperidin-3-ylcarbamate Usage And Synthesis |
| | tert-butyl (3S,5R)-5-fluoropiperidin-3-ylcarbamate Preparation Products And Raw materials |
|