Methyl 3-bromo-2-iodobenzoate manufacturers
|
| | Methyl 3-bromo-2-iodobenzoate Basic information |
| Product Name: | Methyl 3-bromo-2-iodobenzoate | | Synonyms: | Methyl 3-bromo-2-iodobenzoate;3-Bromo-2-iodo-benzoic acid methyl ester;Benzoic acid, 3-bromo-2-iodo-, methyl ester;methyl 3-bromo-2-iodo-benzoate - [M81761];Methyl 3-bromo-2-iodobenzoat | | CAS: | 121772-84-7 | | MF: | C8H6BrIO2 | | MW: | 340.94 | | EINECS: | | | Product Categories: | | | Mol File: | 121772-84-7.mol |  |
| | Methyl 3-bromo-2-iodobenzoate Chemical Properties |
| Boiling point | 103-112 °C(Press: 0.02 Torr) | | density | 2.059±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | liquid | | color | Clear, faint yellow | | InChI | InChI=1S/C8H6BrIO2/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4H,1H3 | | InChIKey | UVSNHIBMLWUZCP-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC(Br)=C1I |
| | Methyl 3-bromo-2-iodobenzoate Usage And Synthesis |
| | Methyl 3-bromo-2-iodobenzoate Preparation Products And Raw materials |
|