| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | N-Acetylglucosamine 6-sulfate sodium salt Basic information |
| | N-Acetylglucosamine 6-sulfate sodium salt Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | color | colorless | | biological source | synthetic | | Optical Rotation | [α]20/D 32.0±2.0, c =0.1% (w/v) in water | | InChI | 1S/C8H15NO9S.Na/c1-3(10)9-5-7(12)6(11)4(18-8(5)13)2-17-19(14,15)16;/h4-8,11-13H,2H2,1H3,(H,9,10)(H,14,15,16);/q;+1/p-1/t4-,5-,6-,7-,8;/m1./s1 | | InChIKey | CBUJZKTVEFVBBG-FROKLYQUSA-M | | SMILES | [Na+].CC(=O)N[C@H]1C(O)O[C@H](COS([O-])(=O)=O)[C@@H](O)[C@@H]1O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N-Acetylglucosamine 6-sulfate sodium salt Usage And Synthesis |
| Uses | N-Acetylglucosamine-6-sulfate-specific β1,4-galactosyltransferase. |
| | N-Acetylglucosamine 6-sulfate sodium salt Preparation Products And Raw materials |
|