CU-T12-9 manufacturers
- CU-T12-9
-
- $48.00
-
2026-07-27
- CAS:1821387-73-8
- Purity: 99.93%
- Supply Ability: 10g
|
| | CU-T12-9 Basic information |
| Product Name: | CU-T12-9 | | Synonyms: | CU-T12-9;N-methyl-4-nitro-2-[4-[4-(trifluoromethyl)phenyl]imidazol-1-yl]aniline;Benzenamine, N-methyl-4-nitro-2-[4-[4-(trifluoromethyl)phenyl]-1H-imidazol-1-yl]-;obesity,inflammatory,carcinoma,cancer,Toll-like Receptor (TLR),TLR1/2,diseases,specific,infectious,bladder,CU-T-12-9,CUT129,Inhibitor,breast,asthma,CU T12 9,inhibit,influenza,pancreatic;CU-T12-9, 10 mM in DMSO;TLR1/TLR2 Agonist II, CU-T12-9 | | CAS: | 1821387-73-8 | | MF: | C17H13F3N4O2 | | MW: | 362.31 | | EINECS: | | | Product Categories: | | | Mol File: | 1821387-73-8.mol |  |
| | CU-T12-9 Chemical Properties |
| Boiling point | 524.3±50.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 250 mg/mL (690.02 mM) | | form | A solid | | pka | 3.53±0.10(Predicted) | | color | Light yellow to yellow | | InChI | 1S/C17H13F3N4O2/c1-21-14-7-6-13(24(25)26)8-16(14)23-9-15(22-10-23)11-2-4-12(5-3-11)17(18,19)20/h2-10,21H,1H3 | | InChIKey | LITXVDAFEYLWQE-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(cc1)c2nc[n](c2)c3c(ccc(c3)[N+](=O)[O-])NC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | CU-T12-9 Usage And Synthesis |
| Uses | CU-T12-9 is a potent TLR1/2 agonist which activates the NFxB pathway and upregulates pro-inflammatory cytokines in vitro. | | Biological Activity | Primary Target
TLR1/TLR2', 'Reversible: yes | | IC 50 | TLR2: 52.9 nM (EC50, in HEK-Blue cells); TLR1: 52.9 nM (EC50, in HEK-Blue cells) | | storage | Store at +4°C |
| | CU-T12-9 Preparation Products And Raw materials |
|