| Company Name: |
OPULENT PHARMA
|
| Tel: |
+91-9106692785 |
| Email: |
info@opulentpharma.com |
| Products Intro: |
Product Name:1-(2,3-dihydro-[2,4'-bibenzo[b]thiophen]-4-yl)piperazine
CAS:1420987-85-4
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | Brexpiprazole Impurity 20 Basic information |
| Product Name: | Brexpiprazole Impurity 20 | | Synonyms: | Brexpiprazole Impurity 20;Piperazine, 1-(2,3-dihydro[2,4'-bibenzo[b]thiophen]-4-yl)-;1-(2,3-Dihydro[2,4’-bibenzo[b]thiophen]-4-yl)-piperazine;1-(2,3-dihydro-[2,4'-bibenzo[b]thiophen]-4-yl)piperazine? (Brexpiprazole Impurity）;1-(2,3-Dihydro[2,4'-bibenzo[b]thiophen]-4-yl)-piperazine;Brexpiprazole Dimer Impurity 19;1-(2,3-dihydro-[2,4'-bibenzo[b]thiophen]-4-yl)piperazine (Brexpiprazole Impurity） | | CAS: | 1420987-85-4 | | MF: | C20H20N2S2 | | MW: | 352.51 | | EINECS: | | | Product Categories: | | | Mol File: | 1420987-85-4.mol |  |
| | Brexpiprazole Impurity 20 Chemical Properties |
| Boiling point | 560.0±50.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | pka | 8.88±0.10(Predicted) | | InChI | InChI=1S/C20H20N2S2/c1-3-14(15-7-12-23-18(15)5-1)20-13-16-17(4-2-6-19(16)24-20)22-10-8-21-9-11-22/h1-7,12,20-21H,8-11,13H2 | | InChIKey | QOLJDCZXEUUSKM-UHFFFAOYSA-N | | SMILES | C12CC(C3C=CC=C4SC=CC=34)SC1=CC=CC=2N1CCNCC1 |
| | Brexpiprazole Impurity 20 Usage And Synthesis |
| Uses | 1-(2,3-Dihydro[2,4''-bibenzo[b]thiophen]-4-yl)-piperazine is a useful synthetic intermediate. |
| | Brexpiprazole Impurity 20 Preparation Products And Raw materials |
|