|
|
| | Carbamic acid, (8-hydroxyoctyl)-, 1,1-dimethylethyl ester Basic information |
| Product Name: | Carbamic acid, (8-hydroxyoctyl)-, 1,1-dimethylethyl ester | | Synonyms: | Carbamic acid, (8-hydroxyoctyl)-, 1,1-dimethylethyl ester;N-Boc-8-aminooctan-1-ol;Carbamic acid, N-(8-hydroxyoctyl)-, 1,1-dimethylethyl ester;8-(Boc-amino)-1-octanol;tert-Butyl n-(8-hydroxyoctyl)carbamate;8-[(t-Butoxycarbonyl)amino]-1-octanol;8-t-Butoxycarbonylaminooctanol;(8-hydroxyoctyl)aminomacetic acidtertbutyl ester | | CAS: | 144183-31-3 | | MF: | C13H27NO3 | | MW: | 245.36 | | EINECS: | | | Product Categories: | | | Mol File: | 144183-31-3.mol |  |
| | Carbamic acid, (8-hydroxyoctyl)-, 1,1-dimethylethyl ester Chemical Properties |
| Melting point | 55-56 °C | | Boiling point | 363.8±25.0 °C(Predicted) | | density | 0.969±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 12.94±0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H27NO3/c1-13(2,3)17-12(16)14-10-8-6-4-5-7-9-11-15/h15H,4-11H2,1-3H3,(H,14,16) | | InChIKey | ZXNLQLJANDBXLE-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCCCCCCO |
| | Carbamic acid, (8-hydroxyoctyl)-, 1,1-dimethylethyl ester Usage And Synthesis |
| | Carbamic acid, (8-hydroxyoctyl)-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|