|
|
| | N-Boc-9-aminononan-1-ol Basic information |
| Product Name: | N-Boc-9-aminononan-1-ol | | Synonyms: | N-Boc-9-aminononan-1-ol;Carbamic acid, N-(9-hydroxynonyl)-, 1,1-dimethylethyl ester;N-Boc-9-aminononan-1-ol ISO 9001:2015 REACH;tert-butyl (9-hydroxynonyl)carbamate;tert-butyl N-(9-hydroxynonyl)carbamate;9-(Boc-amino)-1-nonanol;N-Boc-9-amino-1-nonanol | | CAS: | 1397043-36-5 | | MF: | C14H29NO3 | | MW: | 259.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1397043-36-5.mol |  |
| | N-Boc-9-aminononan-1-ol Chemical Properties |
| Boiling point | 372.7±15.0 °C(Predicted) | | density | 0.962±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 12.94±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C14H29NO3/c1-14(2,3)18-13(17)15-11-9-7-5-4-6-8-10-12-16/h16H,4-12H2,1-3H3,(H,15,17) | | InChIKey | DPOMQRHBUKSSJK-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCCCCCCCO |
| | N-Boc-9-aminononan-1-ol Usage And Synthesis |
| | N-Boc-9-aminononan-1-ol Preparation Products And Raw materials |
|