| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Amino-4-methylphenylboronic acid, pinacol ester Basic information |
| Product Name: | 2-Amino-4-methylphenylboronic acid, pinacol ester | | Synonyms: | 5-Methyl-2-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenylamine;Benzenamine, 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;5-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;2-Amino-4-methylphenylboronic acid, pinacol ester | | CAS: | 863578-36-3 | | MF: | C13H20BNO2 | | MW: | 233.11 | | EINECS: | | | Product Categories: | | | Mol File: | 863578-36-3.mol |  |
| | 2-Amino-4-methylphenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 68 °C(Solv: hexane (110-54-3)) | | Boiling point | 347.2±35.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.02±0.11(Predicted) | | color | Dark Yellow to Dark Beige | | InChI | 1S/C13H20BNO2/c1-9-6-7-10(11(15)8-9)14-16-12(2,3)13(4,5)17-14/h6-8H,15H2,1-5H3 | | InChIKey | PEXRISJTWBBZRY-UHFFFAOYSA-N | | SMILES | CC1(C)OB(C2=CC=C(C)C=C2N)OC1(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Amino-4-methylphenylboronic acid, pinacol ester Usage And Synthesis |
| Uses | 2-Amino-4-methylphenylboronic acid, pinacol ester |
| | 2-Amino-4-methylphenylboronic acid, pinacol ester Preparation Products And Raw materials |
|