| Company Name: |
Shaanxi Didu New Materials Co. Ltd
|
| Tel: |
+86-89586680 +86-13289823923 |
| Email: |
1026@dideu.com |
| Products Intro: |
Product Name:Formalin;Terbufos sulfone
CAS:56070-16-7
Purity:0.99 Package:25KG,200L
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Terbufos Sulfone
CAS:56070-16-7
Purity:100 μg/ML in MeOH Package:1ML
|
| Company Name: |
Shanghai BeiZhuo Biotech Co., Ltd.
|
| Tel: |
021-61119791,13386096464 |
| Email: |
bzswkf@foxmail.com |
| Products Intro: |
Product Name:S-[(tert-butylsulfonyl)Methyl] O,O-diethyl phosphorodithioate
CAS:56070-16-7
Purity:99%
|
|
| | TERBUFOS-SULFONE Basic information |
| Product Name: | TERBUFOS-SULFONE | | Synonyms: | TERBUFOS-SULFONE;TERBUFOS-SULFONE PESTANAL;TERBUFOSSULPHONE;Dithiophosphoric acid O,O-diethyl S-[(tert-butylsulfonyl)methyl] ester;S-[(tert-butylsulfonyl)Methyl] O,O-diethyl phosphorodithioate;Terbufos sulfone Solution, 1000ppm;Terbufos sulfone Solution, 100ppm;Terbos-SulfoneSolution,1,000mg/L,1ml | | CAS: | 56070-16-7 | | MF: | C9H21O4PS3 | | MW: | 320.43 | | EINECS: | | | Product Categories: | | | Mol File: | 56070-16-7.mol |  |
| | TERBUFOS-SULFONE Chemical Properties |
| Boiling point | 411.5±47.0 °C(Predicted) | | density | 1.2000 (rough estimate) | | refractive index | 1.5210 (estimate) | | storage temp. | 2-8°C | | Water Solubility | 407.8mg/L(18.5 ºC) | | BRN | 2279368 | | InChI | 1S/C9H21O4PS3/c1-6-12-14(15,13-7-2)16-8-17(10,11)9(3,4)5/h6-8H2,1-5H3 | | InChIKey | DWZSTEUTHNUVQD-UHFFFAOYSA-N | | SMILES | CCOP(=S)(OCC)SCS(=O)(=O)C(C)(C)C | | EPA Substance Registry System | Terbufos sulfone (56070-16-7) |
| Hazard Codes | T+ | | Risk Statements | 26/27/28 | | Safety Statements | 36/37/39-45 | | RIDADR | UN 2810 6.1/PG 1 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation
Acute Tox. 2 Dermal
Acute Tox. 2 Oral |
| | TERBUFOS-SULFONE Usage And Synthesis |
| Uses | Terbufos Sulfone is used in the inhibition of nicosulfuron metabolite by terbufos metabolites in maize. |
| | TERBUFOS-SULFONE Preparation Products And Raw materials |
|