|
|
| | ASINEX-REAG BAS 13355090 Basic information |
| Product Name: | ASINEX-REAG BAS 13355090 | | Synonyms: | ASINEX-REAG BAS 13355090;CHEMBRDG-BB 9036552;4-[(2-fluorobenzyl)oxy]benzoic acid;Albb-008971;4-[(2-fluorobenzyl)oxy]benzoic acid(SALTDATA: FREE);Benzoic acid, 4-[(2-fluorophenyl)methoxy]- | | CAS: | 405-24-3 | | MF: | C14H11FO3 | | MW: | 246.23 | | EINECS: | | | Product Categories: | | | Mol File: | 405-24-3.mol |  |
| | ASINEX-REAG BAS 13355090 Chemical Properties |
| Melting point | 181 °C | | Boiling point | 396.1±22.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | pka | 4.39±0.10(Predicted) | | form | solid | | InChI | 1S/C14H11FO3/c15-13-4-2-1-3-11(13)9-18-12-7-5-10(6-8-12)14(16)17/h1-8H,9H2,(H,16,17) | | InChIKey | PKWADBDVMROXJB-UHFFFAOYSA-N | | SMILES | O=C(O)C(C=C1)=CC=C1OCC2=CC=CC=C2F |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | ASINEX-REAG BAS 13355090 Usage And Synthesis |
| | ASINEX-REAG BAS 13355090 Preparation Products And Raw materials |
|