| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
343228-20-6 manufacturers
|
| | 343228-20-6 Basic information |
| Product Name: | 343228-20-6 | | Synonyms: | 1,?1'-?Biphenyl]?-?4,?4'-?dicarboxylic acid, 3,?3'-?dimercapto-;4-(4-carboxy-3-sulfanylphenyl)-2-sulfanylbenzoic acid;4-(4-Carboxy-3-3,?3'-?dimercaptobiphenyl-?4,?4'-?dicarboxylic acid)-2-sulfanylbenzoic acid;[1,?1'-?Biphenyl]?-?4,?4'-?dicarboxylic acid, 3,?3'-?dimercapto-;3,3'-Disulfanyl-[1,1'-biphenyl]-4,4'-dicarboxylic acid;3,3'-dimercapto-[1,1'-biphenyl]-4,4'-dicarboxylic acid | | CAS: | 343228-20-6 | | MF: | C14H10O4S2 | | MW: | 306.36 | | EINECS: | | | Product Categories: | | | Mol File: | 343228-20-6.mol |  |
| | 343228-20-6 Chemical Properties |
| Boiling point | 558.5±50.0 °C(Predicted) | | density | 1.494±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 3.11±0.36(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H10O4S2/c15-13(16)9-3-1-7(5-11(9)19)8-2-4-10(14(17)18)12(20)6-8/h1-6,19-20H,(H,15,16)(H,17,18) | | InChIKey | WMVWIXQVNGAZRU-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C(O)=O)C(S)=C2)=CC=C(C(O)=O)C(S)=C1 |
| | 343228-20-6 Usage And Synthesis |
| | 343228-20-6 Preparation Products And Raw materials |
|