| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(4-Hydroxy-3-methoxyphenyl-d3)acetic-2,2-d2 Acid manufacturers
|
| | (4-Hydroxy-3-methoxyphenyl-d3)acetic-2,2-d2 Acid Basic information |
| Product Name: | (4-Hydroxy-3-methoxyphenyl-d3)acetic-2,2-d2 Acid | | Synonyms: | (4-Hydroxy-3-methoxyphenyl-d3)acetic-2,2-d2 Acid ;4-Hydroxy-3-methoxyphenyl-2,5,6-d3-acetic-2,2-d2Acid;[d3]-acetic-alpha.alpha-d2 Acid;Homovanillic Acid-d5;(4-Hydroxy-3-methoxyphenyl-2;High vanillic acid - [d5;(4-Hydroxy-3-methoxyphenyl-2,5,6-d3)acetic-2,2-d2 acid in methanol;4-Hydroxy-3-methoxyphenyl-D3-acetic-D2 Acid solution | | CAS: | 53587-32-9 | | MF: | C9H5D5O4 | | MW: | 187.2 | | EINECS: | | | Product Categories: | | | Mol File: | 53587-32-9.mol |  |
| | (4-Hydroxy-3-methoxyphenyl-d3)acetic-2,2-d2 Acid Chemical Properties |
| Melting point | 141-142o C | | Boiling point | 368.691±27.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.308±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Very Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.394±0.10(predicted) | | color | White to Pale Yellow | | Stability: | Hygroscopic | | Major Application | clinical testing
clinical testing | | InChI | 1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12)/i2D,3D,4D,5D2 | | InChIKey | QRMZSPFSDQBLIX-DVHRWRHBSA-N | | SMILES | O(C)c1c(c(c(c(c1[2H])C(C(=O)O)([2H])[2H])[2H])[2H])O | | CAS Number Unlabeled | 306-08-1 |
| WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | (4-Hydroxy-3-methoxyphenyl-d3)acetic-2,2-d2 Acid Usage And Synthesis |
| Uses | (4-Hydroxy-3-methoxyphenyl-2,5,6-d3)acetic-2,2-d2 Acid (CAS# 53587-32-9) is a useful isotopically labeled research compound. It is used in the labeling of biologically important phenols, indoles, and steroids. | | General Description | Homovanillic acid (HVA) is a urinary metabolite of the catecholamine dopamine and is associated with dopamine levels in the brain. This stable labeled internal standard is suitable for quantitating HVA levels in LC/MS applications such as clinical and diagnostic testing or endocrinology. |
| | (4-Hydroxy-3-methoxyphenyl-d3)acetic-2,2-d2 Acid Preparation Products And Raw materials |
|