|
|
| | Methyl parathion-d6 Basic information |
| Product Name: | Methyl parathion-d6 | | Synonyms: | PARATHION-METHYL D6;(4-nitrophenoxy)-sulfanylidene-bis(trideuteriomethoxy)-λ^{5}-phosphane;METHYL PARATHION-D6 (DIMETHYL-D6);parathion-methyl d6 (dimethyl d6);(4-nitrophenoxy)-sulfanylidene-bis(trideuteriomethoxy)-$l^{5}-phosphane;[2H6]-Methyl Parathion;D6-Parathion-methyl;[2H6]-Parathion-methyl | | CAS: | 96740-32-8 | | MF: | C8H4D6NO5PS | | MW: | 269.25 | | EINECS: | | | Product Categories: | | | Mol File: | 96740-32-8.mol |  |
| | Methyl parathion-d6 Chemical Properties |
| solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil to Low-Melting Solid | | color | Colourless to Off-White | | Stability: | Hygroscopic | | Major Application | agriculture
environmental | | InChI | 1S/C8H10NO5PS/c1-12-15(16,13-2)14-8-5-3-7(4-6-8)9(10)11/h3-6H,1-2H3/i1D3,2D3 | | InChIKey | RLBIQVVOMOPOHC-WFGJKAKNSA-N | | SMILES | S=P(OC([2H])([2H])[2H])(OC([2H])([2H])[2H])OC1=CC=C([N+]([O-])=O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 2 Oral
Acute Tox. 3 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Flam. Liq. 3
STOT RE 2 |
| | Methyl parathion-d6 Usage And Synthesis |
| Uses | METHYL PARATHION-D6 is an derivative of Parathion (P192220), an organophosphate insecticide used on cotton, rice and fruit trees. |
| | Methyl parathion-d6 Preparation Products And Raw materials |
|