| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-[(2,6-Dimethylphenyl)amino]-4-oxobutanoic acid Basic information |
| | 4-[(2,6-Dimethylphenyl)amino]-4-oxobutanoic acid Chemical Properties |
| form | solid | | InChI | 1S/C12H15NO3/c1-8-4-3-5-9(2)12(8)13-10(14)6-7-11(15)16/h3-5H,6-7H2,1-2H3,(H,13,14)(H,15,16) | | InChIKey | ANORGLROOXVGGO-UHFFFAOYSA-N | | SMILES | N(c1c(cccc1C)C)C(=O)CCC(=O)O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-[(2,6-Dimethylphenyl)amino]-4-oxobutanoic acid Usage And Synthesis |
| | 4-[(2,6-Dimethylphenyl)amino]-4-oxobutanoic acid Preparation Products And Raw materials |
|