| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Phenolphthalein glucuronic acid Basic information |
| Product Name: | Phenolphthalein glucuronic acid | | Synonyms: | 1-O-[4-[1-(4-Hydroxyphenyl)-3-oxo-1,3-dihydroisobenzofuran-1-yl]phenyl]-β-D-glucopyranuronic acid;3-[4-(β-D-Glucopyranuronosyloxy)phenyl]-3-(4-hydroxyphenyl)isobenzofuran-1(3H)-one;Phenolphthalein monoglucuronide;Phenolphthalein-monoglucuronide;C016651;Phenolphthalein b-D-glucuronic acid sodium salt;Phenolphthalein mono-β-D-glucosiduronic acid;Phenolphthalein-mono-β-glucuronic acid from rabbit urine | | CAS: | 15265-26-6 | | MF: | C26H22O10 | | MW: | 494.45 | | EINECS: | | | Product Categories: | | | Mol File: | 15265-26-6.mol |  |
| | Phenolphthalein glucuronic acid Chemical Properties |
| Melting point | >165°C (Dec.) | | Boiling point | 804.5±65.0 °C(Predicted) | | density | 1.584±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | H2O: 0.1 g/mL, clear, light yellow | | form | Solid | | pka | 2.77±0.70(Predicted) | | color | Pale Beige to Light Brown | | biological source | rabbit urine | | Water Solubility | H2O: soluble 100mg/mL | | BRN | 68526 | | Stability: | Hygroscopic | | InChIKey | FXJYOZKDDSONLX-XADSOVDISA-N | | SMILES | O[C@@H]1[C@@H](O)[C@@H](O[C@@H]([C@H]1O)C(O)=O)Oc2ccc(cc2)C3(OC(=O)c4ccccc34)c5ccc(O)cc5 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 2938909090 | | Storage Class | 11 - Combustible Solids |
| | Phenolphthalein glucuronic acid Usage And Synthesis |
| Uses | β-glucuronidase test: suitable as substrate, for liver and bacterial enzymes | | Uses | Phenolphthalein β-D-Glucuronide is a commonly used glucuronide conjugate for β-glucuronidase measurements. Highly water-soluble. | | Biochem/physiol Actions | Phenolphthalein β-D-glucuronide is a chromogenic substrate for β-glucuronidase enzyme and the resultant colored product of the reaction is measured at 552 nm. |
| | Phenolphthalein glucuronic acid Preparation Products And Raw materials |
|