|
|
| | 2-CHLORO-5-METHOXYBENZOIC ACID Basic information |
| | 2-CHLORO-5-METHOXYBENZOIC ACID Chemical Properties |
| Melting point | 171-173°C | | Boiling point | 318.1±22.0 °C(Predicted) | | density | 1.352±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 2.78±0.25(Predicted) | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C8H7ClO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | AQHFCRYZABKUEV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC)=CC=C1Cl | | CAS DataBase Reference | 6280-89-3(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2918999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-CHLORO-5-METHOXYBENZOIC ACID Usage And Synthesis |
| Chemical Properties | off-white powder |
| | 2-CHLORO-5-METHOXYBENZOIC ACID Preparation Products And Raw materials |
|