| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-HYDROXY-3-ISOPROPYLBENZOIC ACID Basic information |
| Product Name: | 2-HYDROXY-3-ISOPROPYLBENZOIC ACID | | Synonyms: | 2-HYDROXY-3-ISOPROPYLBENZOIC ACID;3-ISOPROPYLSALICYLIC ACID;3-isopropyl-salicylicaci;2-Hydroxy-3-isopropylbenzoic acid 98%;Benzoic acid, 2-hydroxy-3-(1-methylethyl)-;2-hydroxy-3-propan-2-ylbenzoicaci | | CAS: | 7053-88-5 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | | | Product Categories: | | | Mol File: | 7053-88-5.mol |  |
| | 2-HYDROXY-3-ISOPROPYLBENZOIC ACID Chemical Properties |
| Melting point | 73-75 °C(lit.) | | Boiling point | 301.6±35.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | pka | 3.03±0.10(Predicted) | | form | solid | | InChI | InChI=1S/C10H12O3/c1-6(2)7-4-3-5-8(9(7)11)10(12)13/h3-6,11H,1-2H3,(H,12,13) | | InChIKey | XGAYQDWZIPRBPF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(C(C)C)=C1O |
| | 2-HYDROXY-3-ISOPROPYLBENZOIC ACID Usage And Synthesis |
| Chemical Properties | Isopropyl salicylate is a colorless, transparent liquid. The industrial product is a light yellow to reddish-brown oily liquid with a distinctive aromatic odor. Its bp is 240-248°C/2.26 kPa, n20D is 1.511, and its relative density is 1.090-1.100. It is insoluble in water but soluble in organic solvents. It decomposes in alkaline solutions. | | Uses | 2-Hydroxy-3-isopropylbenzoic acid may be used in the preparation of 3-isopropylgentisic acid. | | General Description | 2-Hydroxy-3-isopropylbenzoic acid is an analog of general anesthetic compound, propofol (2,6-diisopropylphenol). It was investigated for general anesthetic activity in Xenopus laevis tadpoles and for the ability to produce enhancement of submaximal GABA responses. |
| | 2-HYDROXY-3-ISOPROPYLBENZOIC ACID Preparation Products And Raw materials |
|