| Company Name: |
TOSUN PHARM |
| Tel: |
020-66392521-118 18922260391 |
| Email: |
3004261881@qq.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | RO-31-8425 Basic information |
| Product Name: | RO-31-8425 | | Synonyms: | RO-31-8425;BisindolylMaleiMide X . hydrochloride [Ro 31-8425];3-[8-(Aminomethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione;Ro 31-8245;Ro-31-8425 - CAS 131848-97-0 - Calbiochem;RSYYBisindolylmaleimideXhydrochloride;1H-Pyrrole-2,5-dione, 3-[8-(aminomethyl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]-4-(1-methyl-1H-indol-3-yl)- | | CAS: | 131848-97-0 | | MF: | C26H24N4O2 | | MW: | 424.49 | | EINECS: | | | Product Categories: | inhibitor | | Mol File: | 131848-97-0.mol |  |
| | RO-31-8425 Chemical Properties |
| Boiling point | 736.1±60.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | DMSO: 10mg/mL | | form | Red to orange-red solid | | pka | 7.91±0.60(Predicted) | | color | red to orange-red | | InChI | 1S/C26H24N4O2/c1-29-14-18(16-6-2-4-8-19(16)29)23-24(26(32)28-25(23)31)22-17-7-3-5-9-20(17)30-11-10-15(13-27)12-21(22)30/h2-9,14-15H,10-13,27H2,1H3,(H,28,31,32) | | InChIKey | QQKKPWJFHBFCTH-UHFFFAOYSA-N | | SMILES | [n]21c3c(c(c2CC(CC1)CN)C4=C(C(=O)NC4=O)c5c6c([n](c5)C)cccc6)cccc3 |
| WGK Germany | WGK 1 | | HS Code | 2925199590 | | Storage Class | 11 - Combustible Solids |
| | RO-31-8425 Usage And Synthesis |
| Uses | Bisindolylmaleimide X is a selective inhibitor of PKC, also inhibits Cdk2 and GSK-3β. | | Biological Activity | Cell permeable: yes', 'Primary Target
PKC', 'Product competes with ATP.', 'Reversible: yes', 'Target IC50: 15 nM for r at brain PKC; 8 nM for PKCα, 8 nM for PKCβI, 14 nM for PKCβII, 13 nM for PKCγ, and 39 nM for PKCε |
| | RO-31-8425 Preparation Products And Raw materials |
|