| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
4-Benzyloxy-2-formylphenylboronic acid manufacturers
|
| | 4-Benzyloxy-2-formylphenylboronic acid Basic information |
| | 4-Benzyloxy-2-formylphenylboronic acid Chemical Properties |
| Boiling point | 490.2±55.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 8.35±0.53(Predicted) | | color | White to Almost white | | InChI | 1S/C14H13BO4/c16-9-12-8-13(6-7-14(12)15(17)18)19-10-11-4-2-1-3-5-11/h1-9,17-18H,10H2 | | InChIKey | XRARNEIDTRHXKN-UHFFFAOYSA-N | | SMILES | OB(O)c1ccc(OCc2ccccc2)cc1C=O | | CAS DataBase Reference | 139962-97-3(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 36/37/38-43-36 | | Safety Statements | 26-36/37/39-36/37 | | WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | 4-Benzyloxy-2-formylphenylboronic acid Usage And Synthesis |
| | 4-Benzyloxy-2-formylphenylboronic acid Preparation Products And Raw materials |
|