|
|
| | 3,5-Difluorobenzyl bromide Basic information |
| | 3,5-Difluorobenzyl bromide Chemical Properties |
| Boiling point | 65 °C4.5 mm Hg(lit.) | | density | 1.6 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.521(lit.) | | Fp | 179 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Orange to Green | | Specific Gravity | 1.62 | | Sensitive | Lachrymatory | | BRN | 7422062 | | InChI | InChI=1S/C7H5BrF2/c8-4-5-1-6(9)3-7(10)2-5/h1-3H,4H2 | | InChIKey | KVSVNRFSKRFPIL-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC(F)=CC(F)=C1 | | CAS DataBase Reference | 141776-91-2(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Difluorobenzyl bromide(141776-91-2) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36-43 | | Safety Statements | 26-36/37/39-45-27-36/37 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3,5-Difluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | 3,5-Difluorobenzyl bromide is a kind of important medicine intermediate. | | Synthesis | Triphenylphosphine (2.75 g, 10.5 mmol) and carbon tetrabromide (3.48 g, 10.5 mmol) were added to a dry reaction flask followed by the addition of 25 mL of ether and the resulting mixture was stirred at room temperature for 30 min, then an ether solution of 3,5-difluorobenzenemethanol (10.5 mmol) was slowly added to the above mentioned system and the reaction mixture was continued to be stirred at 25C for 40 minutes. At the end of the reaction, petroleum ether was added to the reaction system, and a white precipitate of triphenylphosphine oxide was observed. Most of the triphenylphosphine oxide was removed by filtration, and the obtained filtrate was concentrated in vacuum, and finally, hexane was used as the eluent, and the residue was separated and purified by silica gel chromatography to obtain the target product of 3,5-difluorobenzyl bromide. |
| | 3,5-Difluorobenzyl bromide Preparation Products And Raw materials |
|