| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate Basic information |
| Product Name: | 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate | | Synonyms: | WP 46;4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate,98%;[4-[[(2S,3S)-3-propyloxiran-2-yl]methoxy]phenyl] 4-decoxybenzoate;4-(((2S,3S)-3-Propyloxiran-2-yl)methoxy)phenyl 4-(decyloxy)benzoate;4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate;4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate | | CAS: | 107133-34-6 | | MF: | C29H40O5 | | MW: | 468.62 | | EINECS: | | | Product Categories: | | | Mol File: | 107133-34-6.mol | ![4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate Structure](CAS/GIF/107133-34-6.gif) |
| | 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate Chemical Properties |
| form | liquid crystal | | Optical Rotation | [α]20/D 12°, c = 1 in chloroform-d | | InChIKey | SDWUPBPBMWMRLN-NSOVKSMOSA-N | | SMILES | CCCCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(OC[C@@H]3O[C@H]3CCC)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate Usage And Synthesis |
| Uses | 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate is a ferroelectric liquid crystal. Effect of polymer networks on its smectic-C* phase was studied by high resolution X ray diffraction. Investigations of 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate by a polarizing microscope, optical dispersion and UV-VIS spectroscopy have been conducted. | | General Description | 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate is a ferroelectric liquid crystal. Effect of polymer networks on its smectic-C* phase was studied by high resolution X ray diffraction. Investigations of 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate by a polarizing microscope, optical dispersion and UV-VIS spectroscopy have been conducted. |
| | 4-[(S,S)-2,3-Epoxyhexyloxy]phenyl 4-(decyloxy)benzoate Preparation Products And Raw materials |
|