| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-n-Decyloxybenzoic acid Basic information |
| | 4-n-Decyloxybenzoic acid Chemical Properties |
| Melting point | 94-143 °C(lit.) | | Boiling point | 403.6±18.0 °C(Predicted) | | density | 1.014±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 4.48±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble in water. | | BRN | 2113730 | | InChI | 1S/C17H26O3/c1-2-3-4-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19/h10-13H,2-9,14H2,1H3,(H,18,19) | | InChIKey | NZNICZRIRMGOFG-UHFFFAOYSA-N | | SMILES | CCCCCCCCCCOc1ccc(cc1)C(O)=O | | CAS DataBase Reference | 5519-23-3(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2918.99.4700 | | Storage Class | 11 - Combustible Solids |
| | 4-n-Decyloxybenzoic acid Usage And Synthesis |
| Uses | 4-n-Decyloxybenzoic acid, is used in the syntheis of liquid crystals. It can also be used to react with 3-bromo-propene to produce 5-allyloxy-2-phenyl-[1,3]dioxane. This reaction will need reagent tetra-n-butylammonium bromide and NaH, and the menstruum dimethylformamide. The reaction time is 2 hour with temperature of 20°C, |
| | 4-n-Decyloxybenzoic acid Preparation Products And Raw materials |
|