7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614) manufacturers
|
| | 7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614) Basic information |
| Product Name: | 7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614) | | Synonyms: | 7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614);Quinoline, 7-(difluoromethyl)-1,2,3,4-tetrahydro-;7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614) ISO 9001：2015 REACH;7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline - [D83727];7-(DIFLUOROMETHYL)-1,2,3,4-TETRAHYDROQUINOLINE | | CAS: | 1783624-20-3 | | MF: | C10H11F2N | | MW: | 183.2 | | EINECS: | | | Product Categories: | | | Mol File: | 1783624-20-3.mol |  |
| | 7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614) Chemical Properties |
| Boiling point | 276.0±40.0 °C(Predicted) | | density | 1.143±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 4.42±0.20(Predicted) | | Appearance | Colorless to light yellow Solid-Liquid Mixture | | InChI | InChI=1S/C10H11F2N/c11-10(12)8-4-3-7-2-1-5-13-9(7)6-8/h3-4,6,10,13H,1-2,5H2 | | InChIKey | PGOLXTGHMFUFNX-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(C(F)F)=C2)CCC1 |
| | 7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614) Usage And Synthesis |
| Uses | 7-(Difluoromethyl)-1,2,3,4-tetrahydroquinoline, is a building block used in the synthesis of GNE-781 (D447825), a highly advanced, potent and selective bromodomain inhibitor of cyclic adenosine monophosphate response element binding protein, binding protein (CBP). |
| | 7-(Difluoromethyl)-1,2,3,4-Tetrahydroquinoline(WXC01614) Preparation Products And Raw materials |
|