| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline manufacturers
|
| | 7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline Basic information |
| Product Name: | 7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline | | Synonyms: | 7-(TRIFLUOROMETHYL)-1,2,3,4-TETRAHYDROQUINOLINE;7-TRIFLUOROMETHYL-1,2,3,4-TETRAHYDRO-QUINOLINE HYDROCHLORIDE;1,2,3,4-Tetrahydro-7-(trifluoromethyl)quinoline;Quinoline, 1,2,3,4-tetrahydro-7-(trifluoromethyl)- | | CAS: | 450-62-4 | | MF: | C10H10F3N | | MW: | 201.19 | | EINECS: | | | Product Categories: | Quinoline&Isoquinoline;Miscellaneous | | Mol File: | 450-62-4.mol |  |
| | 7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline Chemical Properties |
| Melting point | 30-32°C | | Boiling point | 135-140°C 22mm | | density | 1.213±0.06 g/cm3(Predicted) | | Fp | 135-140°C/22mm | | storage temp. | 2-8°C, protect from light | | pka | 4.09±0.20(Predicted) | | form | low melting solid | | color | Pale yellow | | BRN | 153990 | | InChI | InChI=1S/C10H10F3N/c11-10(12,13)8-4-3-7-2-1-5-14-9(7)6-8/h3-4,6,14H,1-2,5H2 | | InChIKey | RGZZKZNESVFQKR-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(C(F)(F)F)=C2)CCC1 | | CAS DataBase Reference | 450-62-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline Usage And Synthesis |
| Uses | 7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline is used for stereoselective preparation of difunctionalized dienes. |
| | 7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline Preparation Products And Raw materials |
|