|
|
| | Ethylenediamine tetrakis(ethoxylate-block-propoxylate) tetrol Basic information |
| Product Name: | Ethylenediamine tetrakis(ethoxylate-block-propoxylate) tetrol | | Synonyms: | Ethylenediamine tetrakis(ethoxylate-block-propoxylate) tetrol,Tetronic 90R4;Ethylenediamine ethoxylated propoxylated polymer;EthylenediaMine tetrakis(ethoxylate-block-propoxylate) tetrol average Mn ~7,200;EthylenediaMine tetrakis(propoxylate-block-ethoxylate) tetrol average Mn ~3,600;1,2-Ethanediamine,methyloxirane,oxiranepolymer;1,2-Ethanediamine,polymerwithmethyloxiraneandoxirane;Ethoxylated,propoxylatedethylenediamine;ethylenediaminetetrakis(ethoxylate-b-propoxylate | | CAS: | 26316-40-5 | | MF: | C34H72N2O12 | | MW: | 700.94168 | | EINECS: | 500-047-1 | | Product Categories: | Polymers | | Mol File: | 26316-40-5.mol |  |
| | Ethylenediamine tetrakis(ethoxylate-block-propoxylate) tetrol Chemical Properties |
| Melting point | 21 °C (DSC at peak) | | density | 1.05 g/mL at 25 °C | | refractive index | n20/D 1.455 | | Fp | >230 °F | | form | suspension | | Hydrophilic-Lipophilic Balance (HLB) | 1.0 - 7.0 | | InChIKey | CQHSSFAMLCZVQQ-UHFFFAOYSA-N | | SMILES | C(O)COC(C)COC(C)CN(CC)CC(N(CC(OCC(OCCO)C)C)CC(OCC(OCCO)C)C)(OCC(OCCO)C)C | | LogP | 1.2 at 25℃ | | EPA Substance Registry System | 1,2-Ethanediamine propylene oxide ethylene oxide polymer (26316-40-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43-36 | | Safety Statements | 26-36-36/37 | | RIDADR | 2735 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1B |
| | Ethylenediamine tetrakis(ethoxylate-block-propoxylate) tetrol Usage And Synthesis |
| Uses | Hard and soft surface cleaners, defoamers in coatings and water treatment. Lubricant in metal working, anti-foaming aid and extender for linear and cross-linked polyesters and polyurethanes. | | General Description | Terminal secondary tetrahydroxy-functional oligomer. | | Flammability and Explosibility | Non flammable |
| | Ethylenediamine tetrakis(ethoxylate-block-propoxylate) tetrol Preparation Products And Raw materials |
|