1-(4-Bromophenyl)-4-phenylnaphthalene manufacturers
|
| | 1-(4-Bromophenyl)-4-phenylnaphthalene Basic information |
| | 1-(4-Bromophenyl)-4-phenylnaphthalene Chemical Properties |
| Melting point | 118-119 °C(Solv: hexane (110-54-3); ethyl acetate (141-78-6)) | | Boiling point | 476.7±14.0 °C(Predicted) | | density | 1.329±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C22H15Br/c23-18-12-10-17(11-13-18)20-15-14-19(16-6-2-1-3-7-16)21-8-4-5-9-22(20)21/h1-15H | | InChIKey | KNRVCICRZJAEAQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Br)C=C2)=C2C(C=CC=C2)=C(C2=CC=CC=C2)C=C1 |
| | 1-(4-Bromophenyl)-4-phenylnaphthalene Usage And Synthesis |
| Uses | 1-(4-Bromophenyl)-4-phenylnaphthalene is a material intermediate that can be used in the preparation of electron-blocking materials and hole-transporting materials. |
| | 1-(4-Bromophenyl)-4-phenylnaphthalene Preparation Products And Raw materials |
|