- Acetylspiramycin
-
-
2026-08-06
- CAS:24916-51-6
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kg
- Acetylspiramycin
-
- $55.00
-
2026-05-11
- CAS:24916-51-6
- Purity: 98.00%
- Supply Ability: 10g
- Acetylspiramycin
-
- $10.00
-
2026-03-20
- CAS:24916-51-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | Acetylspiramycin Basic information |
| Product Name: | Acetylspiramycin | | Synonyms: | 9-O-[(2R,5S,6R)-5-(Dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-3-acetate-leucomycin V;9-o-(5-(dimethylamino)tetrahydro-6-methyl-2h-pyran-2-yl)-leucomycin3-ac;foromacidinb;foromacidineb;spiramycin2;spiramycinb;ACETYLSPIRAMYCIN;Acetylspiramycin (ASPM) | | CAS: | 24916-51-6 | | MF: | C45H76N2O15 | | MW: | 885.09 | | EINECS: | 1312995-182-4 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 24916-51-6.mol |  |
| | Acetylspiramycin Chemical Properties |
| Melting point | 130-1330C | | alpha | D20 -86° | | Boiling point | 916.7±65.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Very Slightly, Heated) | | pka | 13.06±0.70(Predicted) | | form | Solid | | color | White to Light Yellow | | InChIKey | TXVWWVGEGBCUMX-HOUNXPESSA-N | | SMILES | O=CCC1CC(C)C(OC2OC(C)C(N(C)C)CC2)C=CC=CCC(OC(=O)CC(OC(=O)C)C(OC)C1OC3OC(C)C(OC4OC(C)C(O)C(O)(C)C4)C(N(C)C)C3O)C | | CAS DataBase Reference | 24916-51-6 |
| | Acetylspiramycin Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Antibiotic substance classified in the erythromycin-carbomycin group | | Definition | ChEBI: A macrolide antibiotic produced by various Streptomyces species. | | in vivo | Acetylspiramycin (25-200 mg/kg/day; Oral gavage (p.o.); 7 days) can significantly enhance the lymphocyte proliferation response of CBA/H mice to PHA, and reduce the activity of lymphokine in a dose-dependent manner[3].
Acetylspiramycin (50-200 mg/kg/day; Oral gavage (p.o.); 14 days) in CBA/H mouse models can increase the efficiency of phagocytosis in mice[4].
| Animal Model: | CBA/H mice | | Dosage: | 25-200 mg/kg/day | | Administration: | Oral gavage (p.o.), 7 days | | Result: | Decreased lymphokine activity in a dose-dependent manner |
| Animal Model: | CBA/H mice[4] | | Dosage: | 50-200 mg/kg/day | | Administration: | Oral gavage (p.o.), 14 days | | Result: | Increased the efficiency of phagocytosis in mice. |
| | IC 50 | Macrolide |
| | Acetylspiramycin Preparation Products And Raw materials |
|