BIS(2-BUTOXYETHYL) ADIPATE manufacturers
- BIS(2-BUTOXYETHYL) ADIPATE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:141-18-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | BIS(2-BUTOXYETHYL) ADIPATE Chemical Properties |
| Melting point | -34 °C | | Boiling point | 217 °C / 11mmHg | | density | 1.00 | | vapor pressure | 0.006Pa at 25℃ | | refractive index | n20/D 1.444(lit.) | | Fp | 199 °C | | solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | 101mg/L at 20℃ | | InChI | InChI=1S/C18H34O6/c1-3-5-11-21-13-15-23-17(19)9-7-8-10-18(20)24-16-14-22-12-6-4-2/h3-16H2,1-2H3 | | InChIKey | IHTSDBYPAZEUOP-UHFFFAOYSA-N | | SMILES | C(OCCOCCCC)(=O)CCCCC(OCCOCCCC)=O | | LogP | 3.78 | | CAS DataBase Reference | 141-18-4 | | EPA Substance Registry System | Hexanedioic acid, bis(2-butoxyethyl) ester (141-18-4) |
| RTECS | AU8450000 | | TSCA | TSCA listed | | HS Code | 2917.12.5000 | | Toxicity | LD50 ipr-rat: 600 mg/kg 14CYAT 2,1882,63 |
| | BIS(2-BUTOXYETHYL) ADIPATE Usage And Synthesis |
| Acute toxicity | Intraperitoneal-rat LD50: 600 mg/kg | | Physical properties | Bis(2-butoxyethyl) Adipate is a liquid, with a density of 0.997 and a boiling point of
208°C (at 4 mmHg). | | Uses | Dibutoxyethyl adipate is used as a plasticizer for polyvinyl
chloride and polyvinyl chloride–acetate copolymers. | | Safety Profile | Moderately toxic byintraperitoneal route. When heated todecomposition it emits acrid smoke and irritating fumes. |
| | BIS(2-BUTOXYETHYL) ADIPATE Preparation Products And Raw materials |
|