- Amoxapine Impurity D
-
- $1.00 / 1Kg
-
2024-07-08
- CAS:3158-91-6
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | 2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one Basic information |
| Product Name: | 2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one | | Synonyms: | 2-CHLORO-DIBENZ(B,F)(1,4)OXAZEPIN-11(10H)ONE;2-CHLORO-10,11-DIHYDRO-11-OXO-DIBENZO[B,F][1,4]OXAZEPINE;8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one;Amoxapine Impurity D;2-Chlorodibenzoxapine;2-Chloro-10,11-Dihydro-11-Oxo-Dibenz[b,f][1,4]oxazepine;2-CHLORO-10,11-DIHYDRO-11-OXO-DIBEN(B,F)(1,4)OXAZEPINE;2-Chloro-10,11-Dihydro-11-Oxo-Diben(B,F)(1,4)Oxazepine(ForAmoxapine) | | CAS: | 3158-91-6 | | MF: | C13H8ClNO2 | | MW: | 245.66 | | EINECS: | 221-602-1 | | Product Categories: | (intermediate of amoxapine);Aromatics Compounds;Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 3158-91-6.mol | ![2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one Structure](CAS/GIF/3158-91-6.gif) |
| | 2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one Chemical Properties |
| Melting point | 242-244°C | | Boiling point | 320.8±41.0 °C(Predicted) | | density | 1.369±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Sparingly, Heated), Methanol Slightly) | | pka | 12.23±0.20(Predicted) | | form | Solid | | color | Pale Beige | | Major Application | pharmaceutical small molecule | | InChI | 1S/C13H8ClNO2/c14-8-5-6-12-10(7-8)15-13(16)9-3-1-2-4-11(9)17-12/h1-7H,(H,15,16) | | InChIKey | CQTGCCLTIDNYHT-UHFFFAOYSA-N | | SMILES | Clc1cc2c(cc1)Oc3c(cccc3)C(=O)N2 | | CAS DataBase Reference | 3158-91-6(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | STOT SE 3 |
| | 2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one Usage And Synthesis |
| Chemical Properties | Tan Solid | | Uses | Amoxapine intermediate. |
| | 2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one Preparation Products And Raw materials |
|