- Halfenprox
-
- $1.00
-
2020-02-01
- CAS:111872-58-3
- Min. Order: 1KG
- Purity: Min98% HPLC
|
| | HALFENPROX Basic information |
| Product Name: | HALFENPROX | | Synonyms: | SIRBON;FUBFENPROX;HALFENPROX;BROFENPROX;ANNIVERSE;2-(4-Bromodifluoromethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether;1-[(2-{4-[Bromo(difluoro)methoxy]phenyl}-2-methylpropoxy)methyl]-3-phenoxybenzene;Halfenprox Solution, 100ppm | | CAS: | 111872-58-3 | | MF: | C24H23BrF2O3 | | MW: | 477.34 | | EINECS: | | | Product Categories: | | | Mol File: | 111872-58-3.mol |  |
| | HALFENPROX Chemical Properties |
| Melting point | <25 °C | | Boiling point | approximate 291℃ | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | BRN | 11404200 | | Henry's Law Constant | 1.9×101 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C24H23BrF2O3/c1-23(2,19-11-13-21(14-12-19)30-24(25,26)27)17-28-16-18-7-6-10-22(15-18)29-20-8-4-3-5-9-20/h3-15H,16-17H2,1-2H3 | | InChIKey | WIFXJBMOTMKRMM-UHFFFAOYSA-N | | SMILES | CC(C)(COCC1=CC(=CC=C1)OC2=CC=CC=C2)C3=CC=C(C=C3)OC(F)(F)Br | | CAS DataBase Reference | 111872-58-3 |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | UN2810 - class 6.1 - PG 3 - EHS - Toxic, liquids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | HALFENPROX Usage And Synthesis |
| Uses | Halfenprox is a pesticide residue in crops. | | Production Methods | Halfenprox is produced through a multi-step chemical synthesis that builds its complex ether-linked structure. The process typically begins with the reaction of 3-phenoxybenzaldehyde and a cyanoacetic acid ester in the presence of a base like triethylamine, forming a key intermediate via a Knoevenagel condensation. This intermediate then undergoes cyclisation with dibromoethane, introducing the ether bridge and forming the central propyl linkage. The final step involves attaching a bromodifluoromethoxy group to the aromatic ring through halogenation and etherification reactions, completing the molecule’s insecticidal functionality. The product is then purified, often by recrystallisation or chromatography, to yield the active halfenprox compound. | | Definition | ChEBI: An aromatic ether the is the 3-phenoxybenzyl ether of 2-(4-difluorobromomethoxyphenyl)-2-methylpropanol. | | Mechanism of action | Broad-spectrum with contact knock-down action and some residual effects. Sodium channel modulator. | | Pesticide Type | Insecticide; Acaricide |
| | HALFENPROX Preparation Products And Raw materials |
|